C18H30N4 — CID 142909327
N-[1-amino-2-[(2Z,5Z)-cycloocta-2,5-dien-1-yl]ethylidene]-N'-piperidin-4-ylpropanimidamide (PubChem CID 142909327) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is N-[1-amino-2-[(2Z,5Z)-cycloocta-2,5-dien-1-yl]ethylidene]-N'-piperidin-4-ylpropanimidamide.
| Compound Name | N-[1-amino-2-[(2Z,5Z)-cycloocta-2,5-dien-1-yl]ethylidene]-N'-piperidin-4-ylpropanimidamide |
|---|---|
| PubChem CID | 142909327 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | N-[1-amino-2-[(2Z,5Z)-cycloocta-2,5-dien-1-yl]ethylidene]-N'-piperidin-4-ylpropanimidamide |
| SMILES | CCC(/N=C(\N)CC1/C=C\C/C=C\CC1)=N\C1CCNCC1 |
| InChI | InChI=1S/C18H30N4/c1-2-18(21-16-10-12-20-13-11-16)22-17(19)14-15-8-6-4-3-5-7-9-15/h3-4,7,9,15-16,20H,2,5-6,8,10-14H2,1H3,(H2,19,21,22)/b4-3-,9-7- |
| InChIKey | ZFZXRIKPRYEDRW-DDYVKQNKSA-N |
| XLogP | 3.21 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|