C17H26N4 — CID 142909241
N'-[C-(cyclohepta-1,3,6-trien-1-ylmethyl)-N-ethylcarbonimidoyl]piperidine-4-carboximidamide (PubChem CID 142909241) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is N'-[C-(cyclohepta-1,3,6-trien-1-ylmethyl)-N-ethylcarbonimidoyl]piperidine-4-carboximidamide.
| Compound Name | N'-[C-(cyclohepta-1,3,6-trien-1-ylmethyl)-N-ethylcarbonimidoyl]piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 142909241 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N'-[C-(cyclohepta-1,3,6-trien-1-ylmethyl)-N-ethylcarbonimidoyl]piperidine-4-carboximidamide |
| SMILES | CC/N=C(CC1=CC=CCC=C1)\N=C(/N)C1CCNCC1 |
| InChI | InChI=1S/C17H26N4/c1-2-20-16(13-14-7-5-3-4-6-8-14)21-17(18)15-9-11-19-12-10-15/h3,5-8,15,19H,2,4,9-13H2,1H3,(H2,18,20,21) |
| InChIKey | HLQOKTFPYIPROY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|