C20H33FN4 — CID 142910791
ethane;4-fluoro-2-methyl-1H-benzimidazole;5-iminobicyclo[4.2.0]octan-1-amine (PubChem CID 142910791) has the molecular formula C20H33FN4 and a molecular weight of 348.51 g/mol. Its IUPAC name is ethane;4-fluoro-2-methyl-1H-benzimidazole;5-iminobicyclo[4.2.0]octan-1-amine.
| Compound Name | ethane;4-fluoro-2-methyl-1H-benzimidazole;5-iminobicyclo[4.2.0]octan-1-amine |
|---|---|
| PubChem CID | 142910791 |
| Molecular Formula | C20H33FN4 |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | ethane;4-fluoro-2-methyl-1H-benzimidazole;5-iminobicyclo[4.2.0]octan-1-amine |
| SMILES | CC.CC.Cc1nc2c(F)cccc2[nH]1.[H]/N=C1\CCCC2(N)CCC12 |
| InChI | InChI=1S/C8H7FN2.C8H14N2.2C2H6/c1-5-10-7-4-2-3-6(9)8(7)11-5;9-7-2-1-4-8(10)5-3-6(7)8;2*1-2/h2-4H,1H3,(H,10,11);6,9H,1-5,10H2;2*1-2H3/b;9-7+;; |
| InChIKey | ZICFHARJJZRWSV-OIQMYFRRSA-N |
| XLogP | 5.36 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|