C18H17FN2O4 — CID 142911423
1-ethyl-5-nitroindole-2-carboxylic acid;2-fluorocyclohepta-1,3,5-triene (PubChem CID 142911423) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is 1-ethyl-5-nitroindole-2-carboxylic acid;2-fluorocyclohepta-1,3,5-triene.
| Compound Name | 1-ethyl-5-nitroindole-2-carboxylic acid;2-fluorocyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142911423 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-ethyl-5-nitroindole-2-carboxylic acid;2-fluorocyclohepta-1,3,5-triene |
| SMILES | CCn1c(C(=O)O)cc2cc([N+](=O)[O-])ccc21.FC1=CCC=CC=C1 |
| InChI | InChI=1S/C11H10N2O4.C7H7F/c1-2-12-9-4-3-8(13(16)17)5-7(9)6-10(12)11(14)15;8-7-5-3-1-2-4-6-7/h3-6H,2H2,1H3,(H,14,15);1-3,5-6H,4H2 |
| InChIKey | PQPZDULWVVWXJC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|