C21H22FNO5 — CID 142912930
4-(3-fluoro-4-methoxyphenyl)-2-imino-3-(3,4,5-trimethoxyphenyl)cyclopent-3-en-1-ol (PubChem CID 142912930) has the molecular formula C21H22FNO5 and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-(3-fluoro-4-methoxyphenyl)-2-imino-3-(3,4,5-trimethoxyphenyl)cyclopent-3-en-1-ol.
| Compound Name | 4-(3-fluoro-4-methoxyphenyl)-2-imino-3-(3,4,5-trimethoxyphenyl)cyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 142912930 |
| Molecular Formula | C21H22FNO5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-(3-fluoro-4-methoxyphenyl)-2-imino-3-(3,4,5-trimethoxyphenyl)cyclopent-3-en-1-ol |
| SMILES | [H]/N=C1/C(c2cc(OC)c(OC)c(OC)c2)=C(c2ccc(OC)c(F)c2)CC1O |
| InChI | InChI=1S/C21H22FNO5/c1-25-16-6-5-11(7-14(16)22)13-10-15(24)20(23)19(13)12-8-17(26-2)21(28-4)18(9-12)27-3/h5-9,15,23-24H,10H2,1-4H3/b23-20+ |
| InChIKey | SNRKYHMFKOZQBP-BSYVCWPDSA-N |
| XLogP | 3.56 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|