C16H23NO — CID 142913270
(E)-2-[2-[(4-ethylcyclohexa-1,5-dien-1-yl)methylimino]ethyl]pent-2-enal (PubChem CID 142913270) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (E)-2-[2-[(4-ethylcyclohexa-1,5-dien-1-yl)methylimino]ethyl]pent-2-enal.
| Compound Name | (E)-2-[2-[(4-ethylcyclohexa-1,5-dien-1-yl)methylimino]ethyl]pent-2-enal |
|---|---|
| PubChem CID | 142913270 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (E)-2-[2-[(4-ethylcyclohexa-1,5-dien-1-yl)methylimino]ethyl]pent-2-enal |
| SMILES | CC/C=C(/C=O)C/C=N/CC1=CCC(CC)C=C1 |
| InChI | InChI=1S/C16H23NO/c1-3-5-16(13-18)10-11-17-12-15-8-6-14(4-2)7-9-15/h5-6,8-9,11,13-14H,3-4,7,10,12H2,1-2H3/b16-5+,17-11+ |
| InChIKey | WDHIOOLEFIEXTI-FNUXQSAISA-N |
| XLogP | 3.90 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|