C10H15N — CID 146639726
N-ethenyl-4-ethylcyclohexa-1,5-dien-1-amine (PubChem CID 146639726) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N-ethenyl-4-ethylcyclohexa-1,5-dien-1-amine.
| Compound Name | N-ethenyl-4-ethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 146639726 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-ethenyl-4-ethylcyclohexa-1,5-dien-1-amine |
| SMILES | C=CNC1=CCC(CC)C=C1 |
| InChI | InChI=1S/C10H15N/c1-3-9-5-7-10(8-6-9)11-4-2/h4-5,7-9,11H,2-3,6H2,1H3 |
| InChIKey | ITQSBLRDWNEACA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |