C19H34IN3O7 — CID 142913940
tert-butyl N-(7-hydroxyheptan-3-yl)carbamate;iodomethane;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 142913940) has the molecular formula C19H34IN3O7 and a molecular weight of 543.40 g/mol. Its IUPAC name is tert-butyl N-(7-hydroxyheptan-3-yl)carbamate;iodomethane;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate.
| Compound Name | tert-butyl N-(7-hydroxyheptan-3-yl)carbamate;iodomethane;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 142913940 |
| Molecular Formula | C19H34IN3O7 |
| Molecular Weight | 543.40 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | tert-butyl N-(7-hydroxyheptan-3-yl)carbamate;iodomethane;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | CCC(CCCCO)NC(=O)OC(C)(C)C.CI.COC(=O)c1nc[nH]c(=O)c1O |
| InChI | InChI=1S/C12H25NO3.C6H6N2O4.CH3I/c1-5-10(8-6-7-9-14)13-11(15)16-12(2,3)4;1-12-6(11)3-4(9)5(10)8-2-7-3;1-2/h10,14H,5-9H2,1-4H3,(H,13,15);2,9H,1H3,(H,7,8,10);1H3 |
| InChIKey | VVKZJDKUIFBBLR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|