C20H21F3O5S — CID 142915403
[3-methoxy-6-(4-methoxyphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-1-yl] trifluoromethanesulfonate (PubChem CID 142915403) has the molecular formula C20H21F3O5S and a molecular weight of 430.44 g/mol. Its IUPAC name is [3-methoxy-6-(4-methoxyphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-1-yl] trifluoromethanesulfonate.
| Compound Name | [3-methoxy-6-(4-methoxyphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142915403 |
| Molecular Formula | C20H21F3O5S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [3-methoxy-6-(4-methoxyphenyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-1-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(C2CCCc3c(cc(OC)cc3OS(=O)(=O)C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C20H21F3O5S/c1-26-16-8-6-13(7-9-16)14-4-3-5-18-15(10-14)11-17(27-2)12-19(18)28-29(24,25)20(21,22)23/h6-9,11-12,14H,3-5,10H2,1-2H3 |
| InChIKey | DYNVHYIOZVHZTR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|