C23H29NO4 — CID 142917183
3-[4-[3-(4-amino-3-ethenyl-2-methylphenoxy)propoxy]-2-ethylphenyl]propanoic acid (PubChem CID 142917183) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-[4-[3-(4-amino-3-ethenyl-2-methylphenoxy)propoxy]-2-ethylphenyl]propanoic acid.
| Compound Name | 3-[4-[3-(4-amino-3-ethenyl-2-methylphenoxy)propoxy]-2-ethylphenyl]propanoic acid |
|---|---|
| PubChem CID | 142917183 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-[4-[3-(4-amino-3-ethenyl-2-methylphenoxy)propoxy]-2-ethylphenyl]propanoic acid |
| SMILES | C=Cc1c(N)ccc(OCCCOc2ccc(CCC(=O)O)c(CC)c2)c1C |
| InChI | InChI=1S/C23H29NO4/c1-4-17-15-19(9-7-18(17)8-12-23(25)26)27-13-6-14-28-22-11-10-21(24)20(5-2)16(22)3/h5,7,9-11,15H,2,4,6,8,12-14,24H2,1,3H3,(H,25,26) |
| InChIKey | GELLYRNJSXIYME-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|