C29H32O4 — CID 69424482
3-[4-[3-[4-ethyl-2-(2-phenylethenyl)phenoxy]propoxy]-2-methylphenyl]propanoic acid (PubChem CID 69424482) has the molecular formula C29H32O4 and a molecular weight of 444.57 g/mol. Its IUPAC name is 3-[4-[3-[4-ethyl-2-(2-phenylethenyl)phenoxy]propoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[3-[4-ethyl-2-(2-phenylethenyl)phenoxy]propoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 69424482 |
| Molecular Formula | C29H32O4 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 3-[4-[3-[4-ethyl-2-(2-phenylethenyl)phenoxy]propoxy]-2-methylphenyl]propanoic acid |
| SMILES | CCc1ccc(OCCCOc2ccc(CCC(=O)O)c(C)c2)c(C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C29H32O4/c1-3-23-11-16-28(26(21-23)12-10-24-8-5-4-6-9-24)33-19-7-18-32-27-15-13-25(22(2)20-27)14-17-29(30)31/h4-6,8-13,15-16,20-21H,3,7,14,17-19H2,1-2H3,(H,30,31) |
| InChIKey | MPFLHSGRPSKPSN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|