C25H27N3O3S — CID 142919480
ethyl 4-[(6-benzamidonaphthalen-2-yl)sulfanylamino]piperidine-1-carboxylate (PubChem CID 142919480) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is ethyl 4-[(6-benzamidonaphthalen-2-yl)sulfanylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(6-benzamidonaphthalen-2-yl)sulfanylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142919480 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | ethyl 4-[(6-benzamidonaphthalen-2-yl)sulfanylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NSc2ccc3cc(NC(=O)c4ccccc4)ccc3c2)CC1 |
| InChI | InChI=1S/C25H27N3O3S/c1-2-31-25(30)28-14-12-21(13-15-28)27-32-23-11-9-19-16-22(10-8-20(19)17-23)26-24(29)18-6-4-3-5-7-18/h3-11,16-17,21,27H,2,12-15H2,1H3,(H,26,29) |
| InChIKey | USUMKNBTGKAMAL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|