C22H30N2O3S — CID 142919326
ethane;ethyl 4-[(4-acetylnaphthalen-1-yl)sulfanylamino]piperidine-1-carboxylate (PubChem CID 142919326) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is ethane;ethyl 4-[(4-acetylnaphthalen-1-yl)sulfanylamino]piperidine-1-carboxylate.
| Compound Name | ethane;ethyl 4-[(4-acetylnaphthalen-1-yl)sulfanylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142919326 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | ethane;ethyl 4-[(4-acetylnaphthalen-1-yl)sulfanylamino]piperidine-1-carboxylate |
| SMILES | CC.CCOC(=O)N1CCC(NSc2ccc(C(C)=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C20H24N2O3S.C2H6/c1-3-25-20(24)22-12-10-15(11-13-22)21-26-19-9-8-16(14(2)23)17-6-4-5-7-18(17)19;1-2/h4-9,15,21H,3,10-13H2,1-2H3;1-2H3 |
| InChIKey | CYFZAWLWEWKPQW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|