C26H32N4O3S — CID 142919364
ethyl 4-[[4-(methylamino)naphthalen-1-yl]sulfanylamino]piperidine-1-carboxylate;2-methylpyridine-3-carbaldehyde (PubChem CID 142919364) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is ethyl 4-[[4-(methylamino)naphthalen-1-yl]sulfanylamino]piperidine-1-carboxylate;2-methylpyridine-3-carbaldehyde.
| Compound Name | ethyl 4-[[4-(methylamino)naphthalen-1-yl]sulfanylamino]piperidine-1-carboxylate;2-methylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 142919364 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | ethyl 4-[[4-(methylamino)naphthalen-1-yl]sulfanylamino]piperidine-1-carboxylate;2-methylpyridine-3-carbaldehyde |
| SMILES | CCOC(=O)N1CCC(NSc2ccc(NC)c3ccccc23)CC1.Cc1ncccc1C=O |
| InChI | InChI=1S/C19H25N3O2S.C7H7NO/c1-3-24-19(23)22-12-10-14(11-13-22)21-25-18-9-8-17(20-2)15-6-4-5-7-16(15)18;1-6-7(5-9)3-2-4-8-6/h4-9,14,20-21H,3,10-13H2,1-2H3;2-5H,1H3 |
| InChIKey | RSSDZOCYEVCVOT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|