C19H27N3O2 — CID 142920231
N,N-diethyl-1-(4-pentoxyphenyl)imidazole-4-carboxamide (PubChem CID 142920231) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N,N-diethyl-1-(4-pentoxyphenyl)imidazole-4-carboxamide.
| Compound Name | N,N-diethyl-1-(4-pentoxyphenyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 142920231 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N,N-diethyl-1-(4-pentoxyphenyl)imidazole-4-carboxamide |
| SMILES | CCCCCOc1ccc(-n2cnc(C(=O)N(CC)CC)c2)cc1 |
| InChI | InChI=1S/C19H27N3O2/c1-4-7-8-13-24-17-11-9-16(10-12-17)22-14-18(20-15-22)19(23)21(5-2)6-3/h9-12,14-15H,4-8,13H2,1-3H3 |
| InChIKey | OMVHHDXLHRWJSN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|