C15H28N2O — CID 142920889
1-[(Z,2E)-2-ethylidenehex-3-enyl]-3-(2-methoxyethyl)piperazine (PubChem CID 142920889) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-[(Z,2E)-2-ethylidenehex-3-enyl]-3-(2-methoxyethyl)piperazine.
| Compound Name | 1-[(Z,2E)-2-ethylidenehex-3-enyl]-3-(2-methoxyethyl)piperazine |
|---|---|
| PubChem CID | 142920889 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-[(Z,2E)-2-ethylidenehex-3-enyl]-3-(2-methoxyethyl)piperazine |
| SMILES | C/C=C(\C=C/CC)CN1CCNC(CCOC)C1 |
| InChI | InChI=1S/C15H28N2O/c1-4-6-7-14(5-2)12-17-10-9-16-15(13-17)8-11-18-3/h5-7,15-16H,4,8-13H2,1-3H3/b7-6-,14-5+ |
| InChIKey | XOCFSFPMEFRNIM-WFRORPSUSA-N |
| XLogP | 2.21 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|