C12H24N2 — CID 145028998
ethane;1-methyl-3-[(2E)-penta-2,4-dien-2-yl]piperazine (PubChem CID 145028998) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is ethane;1-methyl-3-[(2E)-penta-2,4-dien-2-yl]piperazine.
| Compound Name | ethane;1-methyl-3-[(2E)-penta-2,4-dien-2-yl]piperazine |
|---|---|
| PubChem CID | 145028998 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | ethane;1-methyl-3-[(2E)-penta-2,4-dien-2-yl]piperazine |
| SMILES | C=C/C=C(\C)C1CN(C)CCN1.CC |
| InChI | InChI=1S/C10H18N2.C2H6/c1-4-5-9(2)10-8-12(3)7-6-11-10;1-2/h4-5,10-11H,1,6-8H2,2-3H3;1-2H3/b9-5+; |
| InChIKey | OQRAURNEBZOQGF-SZKNIZGXSA-N |
| XLogP | 2.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|