C10H18N2 — CID 145028999
1-methyl-3-[(2E)-penta-2,4-dien-2-yl]piperazine (PubChem CID 145028999) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-methyl-3-[(2E)-penta-2,4-dien-2-yl]piperazine.
| Compound Name | 1-methyl-3-[(2E)-penta-2,4-dien-2-yl]piperazine |
|---|---|
| PubChem CID | 145028999 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-methyl-3-[(2E)-penta-2,4-dien-2-yl]piperazine |
| SMILES | C=C/C=C(\C)C1CN(C)CCN1 |
| InChI | InChI=1S/C10H18N2/c1-4-5-9(2)10-8-12(3)7-6-11-10/h4-5,10-11H,1,6-8H2,2-3H3/b9-5+ |
| InChIKey | FLVHURNDSDLWKN-WEVVVXLNSA-N |
| XLogP | 1.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|