About 1,3-bis(ethenyl)piperazine
1,3-bis(ethenyl)piperazine (PubChem CID 121376458) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 1,3-bis(ethenyl)piperazine.
Molecular Properties
| Compound Name | 1,3-bis(ethenyl)piperazine |
| PubChem CID | 121376458 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1,3-bis(ethenyl)piperazine |
| SMILES | C=CC1CN(C=C)CCN1 |
| InChI | InChI=1S/C8H14N2/c1-3-8-7-10(4-2)6-5-9-8/h3-4,8-9H,1-2,5-7H2 |
| InChIKey | BAGGMKXIVMFJHG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(ethenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(ethenyl)piperazine?
The IUPAC name of 1,3-bis(ethenyl)piperazine (CID 121376458) is 1,3-bis(ethenyl)piperazine.
What is the SMILES notation for 1,3-bis(ethenyl)piperazine?
The canonical SMILES for 1,3-bis(ethenyl)piperazine is C=CC1CN(C=C)CCN1.
What is the InChIKey of 1,3-bis(ethenyl)piperazine?
The InChIKey is BAGGMKXIVMFJHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-8-7-10(4-2)6-5-9-8/h3-4,8-9H,1-2,5-7H2.
What are the key properties of 1,3-bis(ethenyl)piperazine?
1,3-bis(ethenyl)piperazine has a molecular weight of 138.21 g/mol, XLogP of 0.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(ethenyl)piperazine is sourced from PubChem (CID 121376458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).