C8H14N2 — CID 121376458
1,3-bis(ethenyl)piperazine (PubChem CID 121376458) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1,3-bis(ethenyl)piperazine.
| Compound Name | 1,3-bis(ethenyl)piperazine |
|---|---|
| PubChem CID | 121376458 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1,3-bis(ethenyl)piperazine |
| SMILES | C=CC1CN(C=C)CCN1 |
| InChI | InChI=1S/C8H14N2/c1-3-8-7-10(4-2)6-5-9-8/h3-4,8-9H,1-2,5-7H2 |
| InChIKey | BAGGMKXIVMFJHG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|