C9H8N2O2 — CID 142922433
3-(methylamino)furo[3,2-c]pyridine-2-carbaldehyde (PubChem CID 142922433) has the molecular formula C9H8N2O2 and a molecular weight of 176.18 g/mol. Its IUPAC name is 3-(methylamino)furo[3,2-c]pyridine-2-carbaldehyde.
| Compound Name | 3-(methylamino)furo[3,2-c]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 142922433 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-(methylamino)furo[3,2-c]pyridine-2-carbaldehyde |
| SMILES | CNc1c(C=O)oc2ccncc12 |
| InChI | InChI=1S/C9H8N2O2/c1-10-9-6-4-11-3-2-7(6)13-8(9)5-12/h2-5,10H,1H3 |
| InChIKey | FONOFTBWUVHVGL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|