C15H13BN3O2 — CID 162504415
CID 162504415 (PubChem CID 162504415) has the molecular formula C15H13BN3O2 and a molecular weight of 278.10 g/mol.
| Compound Name | CID 162504415 |
|---|---|
| PubChem CID | 162504415 |
| Molecular Formula | C15H13BN3O2 |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | — |
| SMILES | C[B]NC(=O)c1oc2ccncc2c1Nc1ccccc1 |
| InChI | InChI=1S/C15H13BN3O2/c1-16-19-15(20)14-13(18-10-5-3-2-4-6-10)11-9-17-8-7-12(11)21-14/h2-9,18H,1H3,(H,19,20) |
| InChIKey | DFOJSTCQUHOMGZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|