C30H38N4O3 — CID 142922696
(E)-3-[4-[2-amino-2-[(E)-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]iminoethyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 142922696) has the molecular formula C30H38N4O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is (E)-3-[4-[2-amino-2-[(E)-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]iminoethyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[4-[2-amino-2-[(E)-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]iminoethyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 142922696 |
| Molecular Formula | C30H38N4O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (E)-3-[4-[2-amino-2-[(E)-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]iminoethyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | N/C(Cc1ccc(/C=C/C(=O)NOC2CCCCO2)cc1)=N\C(=C\c1ccccc1)CN1CCCCC1 |
| InChI | InChI=1S/C30H38N4O3/c31-28(32-27(21-25-9-3-1-4-10-25)23-34-18-6-2-7-19-34)22-26-14-12-24(13-15-26)16-17-29(35)33-37-30-11-5-8-20-36-30/h1,3-4,9-10,12-17,21,30H,2,5-8,11,18-20,22-23H2,(H2,31,32)(H,33,35)/b17-16+,27-21+ |
| InChIKey | VZTQDLCNLKMENZ-SDOOKUNOSA-N |
| XLogP | 4.70 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|