C17H18F3NOS — CID 142924794
N-[methylidene-oxo-[4-(trifluoromethyl)phenyl]-λ6-sulfanyl]-4-propylaniline (PubChem CID 142924794) has the molecular formula C17H18F3NOS and a molecular weight of 341.40 g/mol. Its IUPAC name is N-[methylidene-oxo-[4-(trifluoromethyl)phenyl]-λ6-sulfanyl]-4-propylaniline.
| Compound Name | N-[methylidene-oxo-[4-(trifluoromethyl)phenyl]-λ6-sulfanyl]-4-propylaniline |
|---|---|
| PubChem CID | 142924794 |
| Molecular Formula | C17H18F3NOS |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[methylidene-oxo-[4-(trifluoromethyl)phenyl]-λ6-sulfanyl]-4-propylaniline |
| SMILES | C=S(=O)(Nc1ccc(CCC)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3NOS/c1-3-4-13-5-9-15(10-6-13)21-23(2,22)16-11-7-14(8-12-16)17(18,19)20/h5-12H,2-4H2,1H3,(H,21,22) |
| InChIKey | HEROHHWCUJVPOW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|