C31H44ClF2N — CID 142925405
2-[1-(2-chloro-4-methylphenyl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline;1,2-difluoro-4-prop-1-en-2-ylbenzene;ethane (PubChem CID 142925405) has the molecular formula C31H44ClF2N and a molecular weight of 504.15 g/mol. Its IUPAC name is 2-[1-(2-chloro-4-methylphenyl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline;1,2-difluoro-4-prop-1-en-2-ylbenzene;ethane.
| Compound Name | 2-[1-(2-chloro-4-methylphenyl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline;1,2-difluoro-4-prop-1-en-2-ylbenzene;ethane |
|---|---|
| PubChem CID | 142925405 |
| Molecular Formula | C31H44ClF2N |
| Molecular Weight | 504.15 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | 2-[1-(2-chloro-4-methylphenyl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline;1,2-difluoro-4-prop-1-en-2-ylbenzene;ethane |
| SMILES | C=C(C)c1ccc(F)c(F)c1.C=C(c1ccc(C)cc1Cl)N1CCC2CCCCC2C1.CC.CC |
| InChI | InChI=1S/C18H24ClN.C9H8F2.2C2H6/c1-13-7-8-17(18(19)11-13)14(2)20-10-9-15-5-3-4-6-16(15)12-20;1-6(2)7-3-4-8(10)9(11)5-7;2*1-2/h7-8,11,15-16H,2-6,9-10,12H2,1H3;3-5H,1H2,2H3;2*1-2H3 |
| InChIKey | HMFVNSFBDZTIEB-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.15 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |