C18H24ClN — CID 142925406
2-[1-(2-chloro-4-methylphenyl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 142925406) has the molecular formula C18H24ClN and a molecular weight of 289.85 g/mol. Its IUPAC name is 2-[1-(2-chloro-4-methylphenyl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | 2-[1-(2-chloro-4-methylphenyl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 142925406 |
| Molecular Formula | C18H24ClN |
| Molecular Weight | 289.85 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[1-(2-chloro-4-methylphenyl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | C=C(c1ccc(C)cc1Cl)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H24ClN/c1-13-7-8-17(18(19)11-13)14(2)20-10-9-15-5-3-4-6-16(15)12-20/h7-8,11,15-16H,2-6,9-10,12H2,1H3 |
| InChIKey | VJYXAJWCZNGOOL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |