C26H25NO6 — CID 142929066
4-[4-[2-(dimethylamino)ethoxy]phenyl]-7-hydroxy-3-(4-methoxyphenoxy)chromen-2-one (PubChem CID 142929066) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is 4-[4-[2-(dimethylamino)ethoxy]phenyl]-7-hydroxy-3-(4-methoxyphenoxy)chromen-2-one.
| Compound Name | 4-[4-[2-(dimethylamino)ethoxy]phenyl]-7-hydroxy-3-(4-methoxyphenoxy)chromen-2-one |
|---|---|
| PubChem CID | 142929066 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-[4-[2-(dimethylamino)ethoxy]phenyl]-7-hydroxy-3-(4-methoxyphenoxy)chromen-2-one |
| SMILES | COc1ccc(Oc2c(-c3ccc(OCCN(C)C)cc3)c3ccc(O)cc3oc2=O)cc1 |
| InChI | InChI=1S/C26H25NO6/c1-27(2)14-15-31-20-7-4-17(5-8-20)24-22-13-6-18(28)16-23(22)33-26(29)25(24)32-21-11-9-19(30-3)10-12-21/h4-13,16,28H,14-15H2,1-3H3 |
| InChIKey | NQSNYSKURGSKED-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|