C22H14Cl2O5 — CID 10320419
3-(2,4-dichlorophenoxy)-4-(4-hydroxyphenyl)-7-methoxychromen-2-one (PubChem CID 10320419) has the molecular formula C22H14Cl2O5 and a molecular weight of 429.26 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)-4-(4-hydroxyphenyl)-7-methoxychromen-2-one.
| Compound Name | 3-(2,4-dichlorophenoxy)-4-(4-hydroxyphenyl)-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 10320419 |
| Molecular Formula | C22H14Cl2O5 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)-4-(4-hydroxyphenyl)-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(-c3ccc(O)cc3)c(Oc3ccc(Cl)cc3Cl)c(=O)oc2c1 |
| InChI | InChI=1S/C22H14Cl2O5/c1-27-15-7-8-16-19(11-15)29-22(26)21(20(16)12-2-5-14(25)6-3-12)28-18-9-4-13(23)10-17(18)24/h2-11,25H,1H3 |
| InChIKey | HBXYGCRQNXABKQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|