C23H17F10NO — CID 142930980
4-[4-fluoro-2-(trifluoromethyl)phenyl]-8-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 142930980) has the molecular formula C23H17F10NO and a molecular weight of 513.38 g/mol. Its IUPAC name is 4-[4-fluoro-2-(trifluoromethyl)phenyl]-8-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-[4-fluoro-2-(trifluoromethyl)phenyl]-8-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 142930980 |
| Molecular Formula | C23H17F10NO |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 4-[4-fluoro-2-(trifluoromethyl)phenyl]-8-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COC(c1ccc2c(c1)C1C=CCC1C(c1ccc(F)cc1C(F)(F)F)N2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H17F10NO/c1-35-20(22(28,29)30,23(31,32)33)11-5-8-18-16(9-11)13-3-2-4-14(13)19(34-18)15-7-6-12(24)10-17(15)21(25,26)27/h2-3,5-10,13-14,19,34H,4H2,1H3 |
| InChIKey | VQUDMLMHSJYTDY-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|