C19H21F3O2 — CID 142931027
2-methyl-4-[2-methyl-5-(trifluoromethoxy)phenyl]-4-phenylbutan-1-ol (PubChem CID 142931027) has the molecular formula C19H21F3O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-methyl-4-[2-methyl-5-(trifluoromethoxy)phenyl]-4-phenylbutan-1-ol.
| Compound Name | 2-methyl-4-[2-methyl-5-(trifluoromethoxy)phenyl]-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 142931027 |
| Molecular Formula | C19H21F3O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-methyl-4-[2-methyl-5-(trifluoromethoxy)phenyl]-4-phenylbutan-1-ol |
| SMILES | Cc1ccc(OC(F)(F)F)cc1C(CC(C)CO)c1ccccc1 |
| InChI | InChI=1S/C19H21F3O2/c1-13(12-23)10-18(15-6-4-3-5-7-15)17-11-16(9-8-14(17)2)24-19(20,21)22/h3-9,11,13,18,23H,10,12H2,1-2H3 |
| InChIKey | XHSAYHYQZBNMMN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |