C26H32N4O3 — CID 142931244
N-methylacetamide;1-[4-[methyl(propyl)amino]phenyl]-3-(4-phenoxyphenyl)urea (PubChem CID 142931244) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-methylacetamide;1-[4-[methyl(propyl)amino]phenyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | N-methylacetamide;1-[4-[methyl(propyl)amino]phenyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 142931244 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-methylacetamide;1-[4-[methyl(propyl)amino]phenyl]-3-(4-phenoxyphenyl)urea |
| SMILES | CCCN(C)c1ccc(NC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1.CNC(C)=O |
| InChI | InChI=1S/C23H25N3O2.C3H7NO/c1-3-17-26(2)20-13-9-18(10-14-20)24-23(27)25-19-11-15-22(16-12-19)28-21-7-5-4-6-8-21;1-3(5)4-2/h4-16H,3,17H2,1-2H3,(H2,24,25,27);1-2H3,(H,4,5) |
| InChIKey | DZNPKVFURHVPKV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|