C18H20F2N4O2S2 — CID 142932250
[4-amino-2-[[(2E,4Z)-6-aminosulfanyl-1-methoxyhepta-2,4-dien-3-yl]amino]-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone (PubChem CID 142932250) has the molecular formula C18H20F2N4O2S2 and a molecular weight of 426.51 g/mol. Its IUPAC name is [4-amino-2-[[(2E,4Z)-6-aminosulfanyl-1-methoxyhepta-2,4-dien-3-yl]amino]-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone.
| Compound Name | [4-amino-2-[[(2E,4Z)-6-aminosulfanyl-1-methoxyhepta-2,4-dien-3-yl]amino]-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 142932250 |
| Molecular Formula | C18H20F2N4O2S2 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [4-amino-2-[[(2E,4Z)-6-aminosulfanyl-1-methoxyhepta-2,4-dien-3-yl]amino]-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone |
| SMILES | COC/C=C(\C=C/C(C)SN)Nc1nc(N)c(C(=O)c2c(F)cccc2F)s1 |
| InChI | InChI=1S/C18H20F2N4O2S2/c1-10(28-22)6-7-11(8-9-26-2)23-18-24-17(21)16(27-18)15(25)14-12(19)4-3-5-13(14)20/h3-8,10H,9,21-22H2,1-2H3,(H,23,24)/b7-6-,11-8+ |
| InChIKey | GLVXUKLWOBDNHJ-BQGCWICQSA-N |
| XLogP | 3.73 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|