C15H18Cl2N4O — CID 142932864
(E)-3-amino-N-[3-(3,4-dichlorophenyl)propyl]-4,5-diiminohex-2-enamide (PubChem CID 142932864) has the molecular formula C15H18Cl2N4O and a molecular weight of 341.24 g/mol. Its IUPAC name is (E)-3-amino-N-[3-(3,4-dichlorophenyl)propyl]-4,5-diiminohex-2-enamide.
| Compound Name | (E)-3-amino-N-[3-(3,4-dichlorophenyl)propyl]-4,5-diiminohex-2-enamide |
|---|---|
| PubChem CID | 142932864 |
| Molecular Formula | C15H18Cl2N4O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (E)-3-amino-N-[3-(3,4-dichlorophenyl)propyl]-4,5-diiminohex-2-enamide |
| SMILES | [H]/N=C(C(/N)=C\C(=O)NCCCc1ccc(Cl)c(Cl)c1)\C(C)=N\[H] |
| InChI | InChI=1S/C15H18Cl2N4O/c1-9(18)15(20)13(19)8-14(22)21-6-2-3-10-4-5-11(16)12(17)7-10/h4-5,7-8,18,20H,2-3,6,19H2,1H3,(H,21,22)/b13-8+,18-9+,20-15+ |
| InChIKey | DXCJDVNSTKNCHM-IQSJLUIJSA-N |
| XLogP | 2.94 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|