C27H27N3O4 — CID 142934837
3-[3-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]-2-methyl-N-(methylamino)anilino]propanoic acid (PubChem CID 142934837) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-[3-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]-2-methyl-N-(methylamino)anilino]propanoic acid.
| Compound Name | 3-[3-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]-2-methyl-N-(methylamino)anilino]propanoic acid |
|---|---|
| PubChem CID | 142934837 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 3-[3-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]-2-methyl-N-(methylamino)anilino]propanoic acid |
| SMILES | CNN(CCC(=O)O)c1cccc(OCc2nc(-c3ccccc3)oc2-c2ccccc2)c1C |
| InChI | InChI=1S/C27H27N3O4/c1-19-23(30(28-2)17-16-25(31)32)14-9-15-24(19)33-18-22-26(20-10-5-3-6-11-20)34-27(29-22)21-12-7-4-8-13-21/h3-15,28H,16-18H2,1-2H3,(H,31,32) |
| InChIKey | DSLICUJVHKBMOD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|