C23H27NO3 — CID 142115095
4-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]-2,4-dimethylpentan-2-ol (PubChem CID 142115095) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 4-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]-2,4-dimethylpentan-2-ol.
| Compound Name | 4-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 142115095 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-[(2,5-diphenyl-1,3-oxazol-4-yl)methoxy]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)(O)CC(C)(C)OCc1nc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C23H27NO3/c1-22(2,25)16-23(3,4)26-15-19-20(17-11-7-5-8-12-17)27-21(24-19)18-13-9-6-10-14-18/h5-14,25H,15-16H2,1-4H3 |
| InChIKey | XQKMAWDVSKPWSL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |