C11H14O — CID 142935097
1-[(1R)-2-cyclohexa-2,4-dien-1-ylcyclopropyl]ethanone (PubChem CID 142935097) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 1-[(1R)-2-cyclohexa-2,4-dien-1-ylcyclopropyl]ethanone.
| Compound Name | 1-[(1R)-2-cyclohexa-2,4-dien-1-ylcyclopropyl]ethanone |
|---|---|
| PubChem CID | 142935097 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1-[(1R)-2-cyclohexa-2,4-dien-1-ylcyclopropyl]ethanone |
| SMILES | CC(=O)[C@@H]1CC1C1C=CC=CC1 |
| InChI | InChI=1S/C11H14O/c1-8(12)10-7-11(10)9-5-3-2-4-6-9/h2-5,9-11H,6-7H2,1H3/t9?,10-,11?/m0/s1 |
| InChIKey | IYMLSSZEYDEQAK-YVNMAJEFSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |