About 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone
1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone (PubChem CID 45086233) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone.
Molecular Properties
| Compound Name | 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone |
| PubChem CID | 45086233 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone |
| SMILES | CC(=O)C1CC2C=CC=CC1C2 |
| InChI | InChI=1S/C11H14O/c1-8(12)11-7-9-4-2-3-5-10(11)6-9/h2-5,9-11H,6-7H2,1H3 |
| InChIKey | YVVLJAXIGUBRTL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone?
The IUPAC name of 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone (CID 45086233) is 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone.
What is the SMILES notation for 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone?
The canonical SMILES for 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone is CC(=O)C1CC2C=CC=CC1C2.
What is the InChIKey of 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone?
The InChIKey is YVVLJAXIGUBRTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-8(12)11-7-9-4-2-3-5-10(11)6-9/h2-5,9-11H,6-7H2,1H3.
What are the key properties of 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone?
1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone has a molecular weight of 162.23 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-bicyclo[4.2.1]nona-2,4-dienyl)ethanone is sourced from PubChem (CID 45086233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).