C26H31FN6O2S2 — CID 142935128
[4-amino-2-[[1-[[6-[2-(cyclopropylamino)ethoxy]-3-pyridinyl]sulfanyl]piperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-methylphenyl)methanone (PubChem CID 142935128) has the molecular formula C26H31FN6O2S2 and a molecular weight of 542.71 g/mol. Its IUPAC name is [4-amino-2-[[1-[[6-[2-(cyclopropylamino)ethoxy]-3-pyridinyl]sulfanyl]piperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-methylphenyl)methanone.
| Compound Name | [4-amino-2-[[1-[[6-[2-(cyclopropylamino)ethoxy]-3-pyridinyl]sulfanyl]piperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-methylphenyl)methanone |
|---|---|
| PubChem CID | 142935128 |
| Molecular Formula | C26H31FN6O2S2 |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | [4-amino-2-[[1-[[6-[2-(cyclopropylamino)ethoxy]-3-pyridinyl]sulfanyl]piperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-methylphenyl)methanone |
| SMILES | Cc1cccc(F)c1C(=O)c1sc(NC2CCN(Sc3ccc(OCCNC4CC4)nc3)CC2)nc1N |
| InChI | InChI=1S/C26H31FN6O2S2/c1-16-3-2-4-20(27)22(16)23(34)24-25(28)32-26(36-24)31-18-9-12-33(13-10-18)37-19-7-8-21(30-15-19)35-14-11-29-17-5-6-17/h2-4,7-8,15,17-18,29H,5-6,9-14,28H2,1H3,(H,31,32) |
| InChIKey | MKAPEMFQCBDDQL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|