C15H22 — CID 142935175
ethane;1-methyl-3-[(1E)-3-methylpenta-1,3,4-trienyl]benzene;molecular hydrogen (PubChem CID 142935175) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is ethane;1-methyl-3-[(1E)-3-methylpenta-1,3,4-trienyl]benzene;molecular hydrogen.
| Compound Name | ethane;1-methyl-3-[(1E)-3-methylpenta-1,3,4-trienyl]benzene;molecular hydrogen |
|---|---|
| PubChem CID | 142935175 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | ethane;1-methyl-3-[(1E)-3-methylpenta-1,3,4-trienyl]benzene;molecular hydrogen |
| SMILES | C=C=C(C)/C=C/c1cccc(C)c1.CC.[H][H] |
| InChI | InChI=1S/C13H14.C2H6.H2/c1-4-11(2)8-9-13-7-5-6-12(3)10-13;1-2;/h5-10H,1H2,2-3H3;1-2H3;1H/b9-8+;; |
| InChIKey | UOSLPAXJCHYGNH-YEUQMBKVSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|