About 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide
1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide (PubChem CID 142935981) has the molecular formula C5H13N3OS
and a molecular weight of 163.25 g/mol. Its IUPAC name is 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide.
Molecular Properties
| Compound Name | 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide |
| PubChem CID | 142935981 |
| Molecular Formula | C5H13N3OS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide |
| SMILES | CC/N=C(\N)S(=O)CCN |
| InChI | InChI=1S/C5H13N3OS/c1-2-8-5(7)10(9)4-3-6/h2-4,6H2,1H3,(H2,7,8) |
| InChIKey | ZDZPIWSLFKOOTR-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide?
The IUPAC name of 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide (CID 142935981) is 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide.
What is the SMILES notation for 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide?
The canonical SMILES for 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide is CC/N=C(\N)S(=O)CCN.
What is the InChIKey of 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide?
The InChIKey is ZDZPIWSLFKOOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3OS/c1-2-8-5(7)10(9)4-3-6/h2-4,6H2,1H3,(H2,7,8).
What are the key properties of 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide?
1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide has a molecular weight of 163.25 g/mol, XLogP of -0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethylsulfinyl)-N'-ethylmethanimidamide is sourced from PubChem (CID 142935981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).