C25H32FN — CID 142939164
1-(cyclopenten-1-ylmethyl)-4-(4-fluorophenyl)piperidine;ethylbenzene (PubChem CID 142939164) has the molecular formula C25H32FN and a molecular weight of 365.54 g/mol. Its IUPAC name is 1-(cyclopenten-1-ylmethyl)-4-(4-fluorophenyl)piperidine;ethylbenzene.
| Compound Name | 1-(cyclopenten-1-ylmethyl)-4-(4-fluorophenyl)piperidine;ethylbenzene |
|---|---|
| PubChem CID | 142939164 |
| Molecular Formula | C25H32FN |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 1-(cyclopenten-1-ylmethyl)-4-(4-fluorophenyl)piperidine;ethylbenzene |
| SMILES | CCc1ccccc1.Fc1ccc(C2CCN(CC3=CCCC3)CC2)cc1 |
| InChI | InChI=1S/C17H22FN.C8H10/c18-17-7-5-15(6-8-17)16-9-11-19(12-10-16)13-14-3-1-2-4-14;1-2-8-6-4-3-5-7-8/h3,5-8,16H,1-2,4,9-13H2;3-7H,2H2,1H3 |
| InChIKey | IZDFQRMLHHEQAA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|