C33H47F2NO5 — CID 142940381
ethane;[1-(4-fluorophenyl)-3-[1-(4-fluorophenyl)azetidin-3-yl]propyl] acetate;4-[(E)-hept-2-en-2-yl]oxybutanoic acid (PubChem CID 142940381) has the molecular formula C33H47F2NO5 and a molecular weight of 575.74 g/mol. Its IUPAC name is ethane;[1-(4-fluorophenyl)-3-[1-(4-fluorophenyl)azetidin-3-yl]propyl] acetate;4-[(E)-hept-2-en-2-yl]oxybutanoic acid.
| Compound Name | ethane;[1-(4-fluorophenyl)-3-[1-(4-fluorophenyl)azetidin-3-yl]propyl] acetate;4-[(E)-hept-2-en-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 142940381 |
| Molecular Formula | C33H47F2NO5 |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.34 |
| IUPAC Name | ethane;[1-(4-fluorophenyl)-3-[1-(4-fluorophenyl)azetidin-3-yl]propyl] acetate;4-[(E)-hept-2-en-2-yl]oxybutanoic acid |
| SMILES | CC.CC(=O)OC(CCC1CN(c2ccc(F)cc2)C1)c1ccc(F)cc1.CCCC/C=C(\C)OCCCC(=O)O |
| InChI | InChI=1S/C20H21F2NO2.C11H20O3.C2H6/c1-14(24)25-20(16-3-5-17(21)6-4-16)11-2-15-12-23(13-15)19-9-7-18(22)8-10-19;1-3-4-5-7-10(2)14-9-6-8-11(12)13;1-2/h3-10,15,20H,2,11-13H2,1H3;7H,3-6,8-9H2,1-2H3,(H,12,13);1-2H3/b;10-7+; |
| InChIKey | XVDZJBMYLUCWOR-PIHOZGLFSA-N |
| XLogP | 8.47 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|