C29H33NO10 — CID 142942279
(10S)-8-ethyl-1,6,7,11-tetrahydroxy-10-[(5S)-5-hydroxy-4-morpholin-4-yloxan-2-yl]oxy-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 142942279) has the molecular formula C29H33NO10 and a molecular weight of 555.58 g/mol. Its IUPAC name is (10S)-8-ethyl-1,6,7,11-tetrahydroxy-10-[(5S)-5-hydroxy-4-morpholin-4-yloxan-2-yl]oxy-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | (10S)-8-ethyl-1,6,7,11-tetrahydroxy-10-[(5S)-5-hydroxy-4-morpholin-4-yloxan-2-yl]oxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 142942279 |
| Molecular Formula | C29H33NO10 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | (10S)-8-ethyl-1,6,7,11-tetrahydroxy-10-[(5S)-5-hydroxy-4-morpholin-4-yloxan-2-yl]oxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | CCC1C[C@H](OC2CC(N3CCOCC3)[C@H](O)CO2)c2c(O)c3c(c(O)c2C1O)C(=O)c1cccc(O)c1C3=O |
| InChI | InChI=1S/C29H33NO10/c1-2-13-10-18(40-19-11-15(17(32)12-39-19)30-6-8-38-9-7-30)21-22(25(13)33)29(37)23-24(28(21)36)27(35)20-14(26(23)34)4-3-5-16(20)31/h3-5,13,15,17-19,25,31-33,36-37H,2,6-12H2,1H3/t13?,15?,17-,18+,19?,25?/m1/s1 |
| InChIKey | ROHDYVUSAJYREF-ZHRURZJXSA-N |
| XLogP | 1.91 |
| TPSA | 166.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|