C13H17N — CID 142943384
azane;2,3-dimethyl-9H-benzo[7]annulene (PubChem CID 142943384) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is azane;2,3-dimethyl-9H-benzo[7]annulene.
| Compound Name | azane;2,3-dimethyl-9H-benzo[7]annulene |
|---|---|
| PubChem CID | 142943384 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | azane;2,3-dimethyl-9H-benzo[7]annulene |
| SMILES | Cc1cc2c(cc1C)CC=CC=C2.N |
| InChI | InChI=1S/C13H14.H3N/c1-10-8-12-6-4-3-5-7-13(12)9-11(10)2;/h3-6,8-9H,7H2,1-2H3;1H3 |
| InChIKey | GTOSYLXJIXWECZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |