C15H21NO3S — CID 142944235
methyl 5-[3-(2-methyl-6-oxopiperidin-1-yl)propyl]thiophene-2-carboxylate (PubChem CID 142944235) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is methyl 5-[3-(2-methyl-6-oxopiperidin-1-yl)propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-(2-methyl-6-oxopiperidin-1-yl)propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 142944235 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl 5-[3-(2-methyl-6-oxopiperidin-1-yl)propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCCN2C(=O)CCCC2C)s1 |
| InChI | InChI=1S/C15H21NO3S/c1-11-5-3-7-14(17)16(11)10-4-6-12-8-9-13(20-12)15(18)19-2/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | IFADZSDQFGCVHC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |