C17H34O — CID 142946638
3,3-dimethyl-2-[(Z)-3-methylhex-3-enyl]cyclopentan-1-ol;propane (PubChem CID 142946638) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(Z)-3-methylhex-3-enyl]cyclopentan-1-ol;propane.
| Compound Name | 3,3-dimethyl-2-[(Z)-3-methylhex-3-enyl]cyclopentan-1-ol;propane |
|---|---|
| PubChem CID | 142946638 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 3,3-dimethyl-2-[(Z)-3-methylhex-3-enyl]cyclopentan-1-ol;propane |
| SMILES | CC/C=C(/C)CCC1C(O)CCC1(C)C.CCC |
| InChI | InChI=1S/C14H26O.C3H8/c1-5-6-11(2)7-8-12-13(15)9-10-14(12,3)4;1-3-2/h6,12-13,15H,5,7-10H2,1-4H3;3H2,1-2H3/b11-6-; |
| InChIKey | ZFPCIWMROBHVKW-AVHZNCSWSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|