C9H11NO — CID 142950097
N-[(3E,6Z)-octa-3,6-dien-1-yn-3-yl]formamide (PubChem CID 142950097) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is N-[(3E,6Z)-octa-3,6-dien-1-yn-3-yl]formamide.
| Compound Name | N-[(3E,6Z)-octa-3,6-dien-1-yn-3-yl]formamide |
|---|---|
| PubChem CID | 142950097 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | N-[(3E,6Z)-octa-3,6-dien-1-yn-3-yl]formamide |
| SMILES | C#C/C(=C\C/C=C\C)NC=O |
| InChI | InChI=1S/C9H11NO/c1-3-5-6-7-9(4-2)10-8-11/h2-3,5,7-8H,6H2,1H3,(H,10,11)/b5-3-,9-7+ |
| InChIKey | XQGKAEOGHQIXBH-AACIIYHXSA-N |
| XLogP | 1.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|