C8H13NS — CID 138509423
N-[(2Z,5E)-hepta-2,5-dien-2-yl]methanethioamide (PubChem CID 138509423) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is N-[(2Z,5E)-hepta-2,5-dien-2-yl]methanethioamide.
| Compound Name | N-[(2Z,5E)-hepta-2,5-dien-2-yl]methanethioamide |
|---|---|
| PubChem CID | 138509423 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | N-[(2Z,5E)-hepta-2,5-dien-2-yl]methanethioamide |
| SMILES | C/C=C/C/C=C(/C)NC=S |
| InChI | InChI=1S/C8H13NS/c1-3-4-5-6-8(2)9-7-10/h3-4,6-7H,5H2,1-2H3,(H,9,10)/b4-3+,8-6- |
| InChIKey | NHZBJRTZQSQALI-MVJHVNNNSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|