C20H29NO2 — CID 142950855
tert-butyl 3-[(Z)-but-2-enyl]-4-ethenyl-8-azaspiro[4.5]deca-1,3-diene-8-carboxylate (PubChem CID 142950855) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is tert-butyl 3-[(Z)-but-2-enyl]-4-ethenyl-8-azaspiro[4.5]deca-1,3-diene-8-carboxylate.
| Compound Name | tert-butyl 3-[(Z)-but-2-enyl]-4-ethenyl-8-azaspiro[4.5]deca-1,3-diene-8-carboxylate |
|---|---|
| PubChem CID | 142950855 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | tert-butyl 3-[(Z)-but-2-enyl]-4-ethenyl-8-azaspiro[4.5]deca-1,3-diene-8-carboxylate |
| SMILES | C=CC1=C(C/C=C\C)C=CC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C20H29NO2/c1-6-8-9-16-10-11-20(17(16)7-2)12-14-21(15-13-20)18(22)23-19(3,4)5/h6-8,10-11H,2,9,12-15H2,1,3-5H3/b8-6- |
| InChIKey | DGRUKOYPDNZACF-VURMDHGXSA-N |
| XLogP | 5.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|