C24H22ClNO4S — CID 142954307
(2-naphthalen-2-yl-2-oxoethyl) 2-chloro-5-piperidin-1-ylsulfinylbenzoate (PubChem CID 142954307) has the molecular formula C24H22ClNO4S and a molecular weight of 455.96 g/mol. Its IUPAC name is (2-naphthalen-2-yl-2-oxoethyl) 2-chloro-5-piperidin-1-ylsulfinylbenzoate.
| Compound Name | (2-naphthalen-2-yl-2-oxoethyl) 2-chloro-5-piperidin-1-ylsulfinylbenzoate |
|---|---|
| PubChem CID | 142954307 |
| Molecular Formula | C24H22ClNO4S |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (2-naphthalen-2-yl-2-oxoethyl) 2-chloro-5-piperidin-1-ylsulfinylbenzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)N2CCCCC2)ccc1Cl)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H22ClNO4S/c25-22-11-10-20(31(29)26-12-4-1-5-13-26)15-21(22)24(28)30-16-23(27)19-9-8-17-6-2-3-7-18(17)14-19/h2-3,6-11,14-15H,1,4-5,12-13,16H2 |
| InChIKey | SWGSJINHFZSKBX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |