C23H31NO6 — CID 142954604
2-morpholin-4-ylethyl (E)-6-(6-methoxy-4,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)hex-4-enoate (PubChem CID 142954604) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl (E)-6-(6-methoxy-4,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)hex-4-enoate.
| Compound Name | 2-morpholin-4-ylethyl (E)-6-(6-methoxy-4,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)hex-4-enoate |
|---|---|
| PubChem CID | 142954604 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-morpholin-4-ylethyl (E)-6-(6-methoxy-4,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)hex-4-enoate |
| SMILES | COc1c(C)c2c(c(C)c1C/C=C/CCC(=O)OCCN1CCOCC1)C(=O)OC2 |
| InChI | InChI=1S/C23H31NO6/c1-16-18(22(27-3)17(2)19-15-30-23(26)21(16)19)7-5-4-6-8-20(25)29-14-11-24-9-12-28-13-10-24/h4-5H,6-15H2,1-3H3/b5-4+ |
| InChIKey | WBLMNWWTZKWTJD-SNAWJCMRSA-N |
| XLogP | 2.74 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|